Systematic / IUPAC Name: 2-(Ethylamino)-1-(4-methylphenyl)-1-butanone
ID: Reference5451
Other Names: 1-Butanone, 2-(ethylamino)-1-(4-methylphenyl)-
Formula: C13H19NO
Class: Drugs of Abuse/Illegal Drugs
4-Methyl-α-ethylaminobutiophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/5/2016 1:26:14 PM |
| InChI | InChI=1S/C13H19NO/c1-4-12(14-5-2)13(15)11-8-6-10(3)7-9-11/h6-9,12,14H,4-5H2,1-3H3 |
| InChI Key | ZTIPDEPKTDPNQE-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C(=O)C1=CC=C(C=C1)C)NCC |
| CAS | |
| Splash | |
| Other Names | 1-Butanone, 2-(ethylamino)-1-(4-methylphenyl)- |
| PubChem | 91698934 |