Systematic / IUPAC Name: 2-(4-Ethoxy-3,5-dimethoxyphenyl)ethanamine
ID: Reference5452
Other Names:
2-(4-Ethoxy-3,5-dimethoxy-phenyl)-ethylamine;
3,5-Dimethoxy-4 ethoxyphenylethylamine;
Benzeneethanamine, 4-ethoxy-3,5-dimethoxy-;
4-Ethoxy mescaline
Formula: C12H19NO3
Class: Drugs of Abuse/Illegal Drugs
Escaline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/8/2016 7:35:18 AM |
| InChI | InChI=1S/C12H19NO3/c1-4-16-12-10(14-2)7-9(5-6-13)8-11(12)15-3/h7-8H,4-6,13H2,1-3H3 |
| InChI Key | RHOGRSKNWDNCDN-UHFFFAOYSA-N |
| Canonical SMILES | CCOC1=C(C=C(C=C1OC)CCN)OC |
| CAS | |
| Splash | |
| Other Names |
2-(4-Ethoxy-3,5-dimethoxy-phenyl)-ethylamine; 3,5-Dimethoxy-4 ethoxyphenylethylamine; Benzeneethanamine, 4-ethoxy-3,5-dimethoxy-; 4-Ethoxy mescaline |