Systematic / IUPAC Name: 2-(2,5-Dimethoxy-3,4-dimethylphenyl)-N-(2-methoxybenzyl)ethanamine
ID: Reference5454
Other Names: Benzeneethanamine, 2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]-3,4-dimethyl-
Formula: C20H27NO3
Class: Drugs of Abuse/Illegal Drugs
25G-NBOMe mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/8/2016 7:44:59 AM |
| InChI | InChI=1S/C20H27NO3/c1-14-15(2)20(24-5)16(12-19(14)23-4)10-11-21-13-17-8-6-7-9-18(17)22-3/h6-9,12,21H,10-11,13H2,1-5H3 |
| InChI Key | VDAUMFACIMNTDA-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=C(C(=C1C)OC)CCNCC2=CC=CC=C2OC)OC |
| CAS | |
| Splash | |
| Other Names | Benzeneethanamine, 2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]-3,4-dimethyl- |