Systematic / IUPAC Name: (4-Fluoro-1-naphthyl)(1-pentyl-1H-indol-3-yl)methanone
ID: Reference5456
Other Names:
Methanone, (4-fluoro-1-naphthalenyl)(1-pentyl-1H-indol-3-yl)-;
(4-Fluoronaphthalen-1-yl)-(1-pentylindol-3-yl)methanone
Formula: C24H22FNO
Class: Drugs of Abuse/Illegal Drugs
JWH 412 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/8/2016 7:12:03 AM |
| InChI | InChI=1S/C24H22FNO/c1-2-3-8-15-26-16-21(19-11-6-7-12-23(19)26)24(27)20-13-14-22(25)18-10-5-4-9-17(18)20/h4-7,9-14,16H,2-3,8,15H2,1H3 |
| InChI Key | HDWMKVHXWFNFQW-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=C(C4=CC=CC=C43)F |
| CAS | 1364933594 |
| Splash | |
| Other Names |
Methanone, (4-fluoro-1-naphthalenyl)(1-pentyl-1H-indol-3-yl)-; (4-Fluoronaphthalen-1-yl)-(1-pentylindol-3-yl)methanone |
| ChEMBL | CHEMBL2206855 |
| PubChem | 71454236 |
| ChemSpider | 28647803 |