Systematic / IUPAC Name: 4-[(E)-2-(3,5-Dihydroxyphenyl)ethenyl]benzene-1,2-diol
ID: Reference546
Other Names:
3-Hydroxyresveratol;
1,2-Benzenediol, 4-(2-(3,5-dihydroxyphenyl)ethenyl)-, (E)-;
4-[(E)-2-(3,5-Dihydroxyphenyl)vinyl]benzene-1,2-diol;
(E)-4-[2-(3,5-Dihydroxyphenyl)ethenyl]1,2-benzenediol
Formula: C14H12O4
Class: Endogenous Metabolites
Piceatannol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 4 |
| No. of Spectra | 2257 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 2/4/2015 11:10:41 AM |
| InChI | InChI=1S/C14H12O4/c15-11-5-10(6-12(16)8-11)2-1-9-3-4-13(17)14(18)7-9/h1-8,15-18H/b2-1+ |
| InChI Key | CDRPUGZCRXZLFL-OWOJBTEDSA-N |
| Canonical SMILES | C1=CC(=C(C=C1/C=C/C2=CC(=CC(=C2)O)O)O)O |
| CAS | 10083246 |
| Splash | |
| Other Names |
3-Hydroxyresveratol; 1,2-Benzenediol, 4-(2-(3,5-dihydroxyphenyl)ethenyl)-, (E)-; 4-[(E)-2-(3,5-Dihydroxyphenyl)vinyl]benzene-1,2-diol; (E)-4-[2-(3,5-Dihydroxyphenyl)ethenyl]1,2-benzenediol |
| ChEMBL | CHEMBL69863 |
| KEGG | C05901 |
| ChemIDPlus | 010083246; 004339713 |
| HMDb | HMDB04215 |
| Wikipedia | Piceatannol |
| ChemSpider | 581006 |
| ChEBI | CHEBI:28814 |
| PubChem | 667639 |