Systematic / IUPAC Name: 2-Chloro-N-(2,4-dimethyl-3-thienyl)-N-(1-methoxy-2-propanyl)acetamide
ID: Reference55
Other Names:
Acetamide, 2-chloro-N-(2,4-dimethyl-3-thienyl)-N-(2-methoxy-1-methylethyl)-;
Frontier herbicide
Formula: C12H18ClNO2S
Class: Pesticides/Herbicides
Dimethenamid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 1589 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 10/10/2016 11:20:17 AM |
| InChI | InChI=1S/C12H18ClNO2S/c1-8-7-17-10(3)12(8)14(11(15)5-13)9(2)6-16-4/h7,9H,5-6H2,1-4H3 |
| InChI Key | JLYFCTQDENRSOL-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CSC(=C1N(C(C)COC)C(=O)CCl)C |
| CAS | 87674688 |
| Splash | |
| Other Names |
Acetamide, 2-chloro-N-(2,4-dimethyl-3-thienyl)-N-(2-methoxy-1-methylethyl)-; Frontier herbicide |
| ChemSpider | 82842 |
| Wikipedia | Dimethenamid |
| PubChem | 91744 |
| ChEMBL | CHEMBL1565335 |
| ChemIDPlus | 087674688 |
| KEGG | C18499 |