Systematic / IUPAC Name: (6aR,10aR)-6,6,9-Trimethyl-3-(2-phenyl-2-propanyl)-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-1-ol
ID: Reference5512
Other Names:
(6aR,10aR)-6,6,9-Trimethyl-3-(2-phenylpropan-2-yl)-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-1-ol;
6aR,7,10,10aR-Tetrahydro-6,6,9-trimethyl-3-(1-methyl-1-phenylethyl)-6H-dibenzo[b,d]pyran-1-ol
Formula: C25H30O2
Class: Drugs of Abuse/Illegal Drugs
KM 233 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/16/2016 8:14:42 AM |
| InChI | InChI=1S/C25H30O2/c1-16-11-12-20-19(13-16)23-21(26)14-18(15-22(23)27-25(20,4)5)24(2,3)17-9-7-6-8-10-17/h6-11,14-15,19-20,26H,12-13H2,1-5H3/t19-,20-/m1/s1 |
| InChI Key | GZYXCXRHVALIJD-WOJBJXKFSA-N |
| Canonical SMILES | CC1=CCC2C(C1)C3=C(C=C(C=C3O)C(C)(C)C4=CC=CC=C4)OC2(C)C |
| CAS | 628263229 |
| Splash | |
| Other Names |
(6aR,10aR)-6,6,9-Trimethyl-3-(2-phenylpropan-2-yl)-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-1-ol; 6aR,7,10,10aR-Tetrahydro-6,6,9-trimethyl-3-(1-methyl-1-phenylethyl)-6H-dibenzo[b,d]pyran-1-ol |
| ChemSpider | 8423597 |
| PubChem | 10248110 |
| Wikipedia | KM-233 |
| ChEMBL | CHEMBL119592 |