Systematic / IUPAC Name: 3'-Carbamoyl-3-biphenylyl 10-undecyn-1-ylcarbamate
ID: Reference5515
Other Names:
[3-(3-Carbamoylphenyl)phenyl] N-undec-10-ynylcarbamate;
3'-Carbamoyl-biphenyl-3-yl-undecynecarbamate;
Carbamic acid, N-10-undecyn-1-yl, 3'-(aminocarbonyl)[1,1'-biphenyl]-3-yl ester
Formula: C25H30N2O3
Class: Drugs of Abuse/Illegal Drugs
JP104 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/16/2016 9:25:12 AM |
| InChI | InChI=1S/C25H30N2O3/c1-2-3-4-5-6-7-8-9-10-17-27-25(29)30-23-16-12-14-21(19-23)20-13-11-15-22(18-20)24(26)28/h1,11-16,18-19H,3-10,17H2,(H2,26,28)(H,27,29) |
| InChI Key | BCKBOXGAYIOHDQ-UHFFFAOYSA-N |
| Canonical SMILES | C#CCCCCCCCCCNC(=O)OC1=CC=CC(=C1)C2=CC(=CC=C2)C(=O)N |
| CAS | 887264451 |
| Splash | |
| Other Names |
[3-(3-Carbamoylphenyl)phenyl] N-undec-10-ynylcarbamate; 3'-Carbamoyl-biphenyl-3-yl-undecynecarbamate; Carbamic acid, N-10-undecyn-1-yl, 3'-(aminocarbonyl)[1,1'-biphenyl]-3-yl ester |
| ChemSpider | 26458551 |
| ChEMBL | CHEMBL3099391 |
| PubChem | 24860363 |