Systematic / IUPAC Name: 2-(4-Isopropyl-2,5-dimethoxyphenyl)-N-(2-methoxybenzyl)ethanamine
ID: Reference5533
Other Names:
2-(2,5-Dimethoxy-4-(propan-2-yl)phenyl)-N-(2-methoxybenzyl)ethanamine ;
Benzeneethanamine, 2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]-4-(1-methylethyl)-
Formula: C21H29NO3
Class: Drugs of Abuse/Illegal Drugs
25iP-NBOMe mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/19/2016 6:28:02 AM |
| InChI | InChI=1S/C21H29NO3/c1-15(2)18-13-20(24-4)16(12-21(18)25-5)10-11-22-14-17-8-6-7-9-19(17)23-3/h6-9,12-13,15,22H,10-11,14H2,1-5H3 |
| InChI Key | KMZZEEDFQLXSQF-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)C1=C(C=C(C(=C1)OC)CCNCC2=CC=CC=C2OC)OC |
| CAS | |
| Splash | |
| Other Names |
2-(2,5-Dimethoxy-4-(propan-2-yl)phenyl)-N-(2-methoxybenzyl)ethanamine ; Benzeneethanamine, 2,5-dimethoxy-N-[(2-methoxyphenyl)methyl]-4-(1-methylethyl)- |