Systematic / IUPAC Name: 2-(7-Fluoro-1H-indol-3-yl)ethanamine
ID: Reference5540
Other Names:
1H-Indole-3-ethanamine, 7-fluoro-;
3-(2-Aminoethyl)-7-fluoroindole
Formula: C10H11FN2
Class: Drugs of Abuse/Illegal Drugs
7-Fluoro tryptamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/19/2016 9:58:22 AM |
| InChI | InChI=1S/C10H11FN2/c11-9-3-1-2-8-7(4-5-12)6-13-10(8)9/h1-3,6,13H,4-5,12H2 |
| InChI Key | QRAWNNQNLQPNIZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C(=C1)F)NC=C2CCN |
| CAS | |
| Splash | |
| Other Names |
1H-Indole-3-ethanamine, 7-fluoro-; 3-(2-Aminoethyl)-7-fluoroindole |
| ChEMBL | CHEMBL205229 |
| PubChem | 2769362 |
| ChemSpider | 2049887 |