Systematic / IUPAC Name: N-(3-{3-[(5-Phenylthieno[2,3-d]pyrimidin-4-yl)amino]propoxy}phenyl)acetamide
ID: Reference5549
Other Names: Acetamide, N-(3-{3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]propoxy}phenyl)-
Formula: C23H22N4O2S
N-(3-{3-[(5-Phenylthieno[2,3-d]pyrimidin-4-yl)amino]propoxy}phenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 8:23:24 AM |
| InChI | InChI=1S/C23H22N4O2S/c1-16(28)27-18-9-5-10-19(13-18)29-12-6-11-24-22-21-20(17-7-3-2-4-8-17)14-30-23(21)26-15-25-22/h2-5,7-10,13-15H,6,11-12H2,1H3,(H,27,28)(H,24,25,26) |
| InChI Key | IOADHNDYDOUCAP-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC1=CC(=CC=C1)OCCCNC2=C3C(=CSC3=NC=N2)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-(3-{3-[(5-phenylthieno[2,3-d]pyrimidin-4-yl)amino]propoxy}phenyl)- |