Systematic / IUPAC Name: 4-Heptyl-N-[(5-methyl-1,2-oxazol-3-yl)carbamothioyl]benzamide
ID: Reference5551
Other Names:
N-(4-Heptylbenzoyl)-N'-(5-methyl-3-isoxazolyl)thiourea ;
Benzamide, 4-heptyl-N-{[(5-methyl-3-isoxazolyl)amino]thioxomethyl}-
Formula: C19H25N3O2S
N-(4-Heptylbenzoyl)-N'-(5-methyl-3-isoxazolyl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 222 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 8:39:26 AM |
| InChI | InChI=1S/C19H25N3O2S/c1-3-4-5-6-7-8-15-9-11-16(12-10-15)18(23)21-19(25)20-17-13-14(2)24-22-17/h9-13H,3-8H2,1-2H3,(H2,20,21,22,23,25) |
| InChI Key | MVMMGEDPXZLSQW-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCC1=CC=C(C=C1)C(=O)NC(=S)NC2=NOC(=C2)C |
| CAS | |
| Splash | |
| Other Names |
N-(4-Heptylbenzoyl)-N'-(5-methyl-3-isoxazolyl)thiourea ; Benzamide, 4-heptyl-N-{[(5-methyl-3-isoxazolyl)amino]thioxomethyl}- |