Systematic / IUPAC Name: 2-Amino-6-chloro-4-phenyl-3-quinolinecarbonitrile
ID: Reference5554
Other Names: 3-Quinolinecarbonitrile, 2-amino-6-chloro-4-phenyl-
Formula: C16H10ClN3
2-Amino-6-chloro-4-phenylquinoline-3-carbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 9:07:22 AM |
| InChI | InChI=1S/C16H10ClN3/c17-11-6-7-14-12(8-11)15(10-4-2-1-3-5-10)13(9-18)16(19)20-14/h1-8H,(H2,19,20) |
| InChI Key | UBEKCEMXDFJEDN-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=C(C(=NC3=C2C=C(C=C3)Cl)N)C#N |
| CAS | |
| Splash | |
| Other Names | 3-Quinolinecarbonitrile, 2-amino-6-chloro-4-phenyl- |