Systematic / IUPAC Name: 1-Isopropyl-3-[2-(4-pyridinyl)ethyl]thiourea
ID: Reference5561
Other Names:
N-Isopropyl-N'-[2-(4-pyridyl)ethyl]thiourea ;
Thiourea, N-(1-methylethyl)-N'-[2-(4-pyridinyl)ethyl]-
Formula: C11H17N3S
N-Isopropyl-N'-[2-(4-pyridyl)ethyl]thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 10:01:04 AM |
| InChI | InChI=1S/C11H17N3S/c1-9(2)14-11(15)13-8-5-10-3-6-12-7-4-10/h3-4,6-7,9H,5,8H2,1-2H3,(H2,13,14,15) |
| InChI Key | OXJKLXTWTNZEKX-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)NC(=S)NCCC1=CC=NC=C1 |
| CAS | |
| Splash | |
| Other Names |
N-Isopropyl-N'-[2-(4-pyridyl)ethyl]thiourea ; Thiourea, N-(1-methylethyl)-N'-[2-(4-pyridinyl)ethyl]- |