Systematic / IUPAC Name: 5-(3,4-Dichlorophenyl)-1-(2,4-dimethylphenyl)-1H-tetrazole
ID: Reference5565
Other Names: 1H-Tetrazole, 5-(3,4-dichlorophenyl)-1-(2,4-dimethylphenyl)-
Formula: C15H12Cl2N4
5-(3,4-Dichlorophenyl)-1-(2,4-dimethylphenyl)-1H-1,2,3,4-tetraazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 10:24:39 AM |
| InChI | InChI=1S/C15H12Cl2N4/c1-9-3-6-14(10(2)7-9)21-15(18-19-20-21)11-4-5-12(16)13(17)8-11/h3-8H,1-2H3 |
| InChI Key | LNGPFUXZZUNYMX-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C=C1)N2C(=NN=N2)C3=CC(=C(C=C3)Cl)Cl)C |
| CAS | |
| Splash | |
| Other Names | 1H-Tetrazole, 5-(3,4-dichlorophenyl)-1-(2,4-dimethylphenyl)- |