Systematic / IUPAC Name: 17-Hydroxy-10,13,17-trimethyl-2,6,7,8,9,11,12,14,15,
16-decahydro-1H-cyclopenta[a]phenanthren-3-one
ID: Reference557
Other Names:
Methyltestosterone;
17-Methyltestosterone;
Oreton methyl;
Methyltestosteronum;
17β-Hydroxy-17-methylandrost-4-en-3-one
; more
Formula: C20H30O2
Class: Therapeutics/Prescription Drugs Sports Doping Drugs
17α-Methyltestosterone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/23/2015 9:49:19 AM |
| InChI | InChI=1S/C20H30O2/c1-18-9-6-14(21)12-13(18)4-5-15-16(18)7-10-19(2)17(15)8-11-20(19,3)22/h12,15-17,22H,4-11H2,1-3H3/t15-,16+,17+,18+,19+,20+/m1/s1 |
| InChI Key | GCKMFJBGXUYNAG-HLXURNFRSA-N |
| Canonical SMILES | CC12CCC(=O)C=C1CCC3C2CCC4(C3CCC4(C)O)C |
| CAS | 58184 |
| Splash | |
| Other Names |
Methyltestosterone; 17-Methyltestosterone; Oreton methyl; Methyltestosteronum; 17β-Hydroxy-17-methylandrost-4-en-3-one; 17α-Methyl-3-oxo-4-androsten-17β-ol; 4-Androstene-17α-methyl-17β-ol-3-one; 17-Methyltestosteron; Androst-4-en-3-one, 17-hydroxy-17-methyl-, (17β)-; 17α-Methyl-δ-androsten-17β-ol-3-one; Androst-4-en-3-one, 17β-hydroxy-17-methyl-; 17α-Methyl-4-androsten-17β-ol-3-one; Testosterone, 17-methyl-; 17β-Hydroxy-17α-methyl-4-androsten-3-one; 17α-Methyl-δ(4)-androsten-17β-ol-3-one; Testred; Android; Virilon; Mesterone; Metandren; Synandrotabs; Testhormone; Andrometh; Androsan; Anertan; Dumogran; Hormale; Malestrone; Malogen; Masenone; Mastestona; Metestone; Methitest; Metrone; Oraviron; Steronyl; Synandrets; Syndren; Testora; Mucorettes; Oreton-m; V-Man; Android 5; Homandren; Android 25; Estratest; Orchisterone-m; Testovis depot; Metiltestosterona; Glosso sterandryl; Neo-homobreol |
| HMDb | HMDB15655 |
| ChEBI | CHEBI:27436 |
| ChEMBL | CHEMBL1395 |
| PubChem | 6010 |
| ChemSpider | 5788 |
| KEGG | C07198; D00408 |
| ChemIDPlus | 000058184 |
| Wikipedia | Methyltestosterone |