Systematic / IUPAC Name: 4-{[(2-Phenoxy-3-pyridinyl)carbonyl]oxy}-10-oxa-4-azatricyclo[5.2.1.0~2,6~]dec-8-ene-3,5-dione
ID: Reference5570
Other Names: 4,7-Epoxy-1H-isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[[(2-phenoxy-3-pyridinyl)carbonyl]oxy]-
Formula: C20H14N2O6
3,5-Dioxo-10-oxa-4-azatricyclo[5.2.1.0~2,6~]dec-8-en-4-yl 2-phenoxynicotinate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 11:32:34 AM |
| InChI | InChI=1S/C20H14N2O6/c23-18-15-13-8-9-14(27-13)16(15)19(24)22(18)28-20(25)12-7-4-10-21-17(12)26-11-5-2-1-3-6-11/h1-10,13-16H |
| InChI Key | CGKUMULTCAAZHU-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)OC2=C(C=CC=N2)C(=O)ON3C(=O)C4C5C=CC(C4C3=O)O5 |
| CAS | |
| Splash | |
| Other Names | 4,7-Epoxy-1H-isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-[[(2-phenoxy-3-pyridinyl)carbonyl]oxy]- |