Systematic / IUPAC Name: 3,5-Dinitro-4-propylbenzoic acid
ID: Reference5573
Other Names: Benzoic acid,3,5-dinitro-4-propyl-
Formula: C10H10N2O6
3,5-Dinitro-4-propylbenzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 92 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 11:47:15 AM |
| InChI | InChI=1S/C10H10N2O6/c1-2-3-7-8(11(15)16)4-6(10(13)14)5-9(7)12(17)18/h4-5H,2-3H2,1H3,(H,13,14) |
| InChI Key | IJLVRZKLSKJPBO-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 248595122 |
| Splash | |
| Other Names | Benzoic acid,3,5-dinitro-4-propyl- |