Systematic / IUPAC Name: 6-(3,4-Dimethoxyphenyl)-2-(3,5-dimethoxyphenyl)-5-methylthieno[2,3-d]pyrimidin-4-amine
ID: Reference5589
Other Names: Thieno[2,3-d]pyrimidin-4-amine, 6-(3,4-dimethoxyphenyl)-2-(3,5-dimethoxyphenyl)-5-methyl-
Formula: C23H23N3O4S
6-(3,4-Dimethoxyphenyl)-2-(3,5-dimethoxyphenyl)-5-methylthieno[2,3-d]pyrimidin-4-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 1:47:07 PM |
| InChI | InChI=1S/C23H23N3O4S/c1-12-19-21(24)25-22(14-8-15(27-2)11-16(9-14)28-3)26-23(19)31-20(12)13-6-7-17(29-4)18(10-13)30-5/h6-11H,1-5H3,(H2,24,25,26) |
| InChI Key | QEEOTZDNPMEFRT-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC2=NC(=NC(=C12)N)C3=CC(=CC(=C3)OC)OC)C4=CC(=C(C=C4)OC)OC |
| CAS | |
| Splash | |
| Other Names | Thieno[2,3-d]pyrimidin-4-amine, 6-(3,4-dimethoxyphenyl)-2-(3,5-dimethoxyphenyl)-5-methyl- |