Systematic / IUPAC Name: (E)-N-[(2,6-Dichlorobenzyl)oxy]-1-(2-thienyl)methanimine
ID: Reference5590
Other Names: 2-Thiophenecarboxaldehyde, O-[(2,6-dichlorophenyl)methyl]oxime
Formula: C12H9Cl2NOS
Thiophene-2-carbaldehyde O-2-(2,6-dichlorobenzyl)oxime mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/12/2016 1:55:02 PM |
| InChI | InChI=1S/C12H9Cl2NOS/c13-11-4-1-5-12(14)10(11)8-16-15-7-9-3-2-6-17-9/h1-7H,8H2/b15-7+ |
| InChI Key | PDVHJZDTQHGUSF-VIZOYTHASA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)Cl)CON=CC2=CC=CS2)Cl |
| CAS | |
| Splash | |
| Other Names | 2-Thiophenecarboxaldehyde, O-[(2,6-dichlorophenyl)methyl]oxime |
| PubChem | 9583338 |
| ChemSpider | 7857485 |
| ChEMBL | CHEMBL3210335 |