Systematic / IUPAC Name: {[Bis(2-chloro-6-fluorobenzyl)amino]oxy}(cyclopropyl)methanone
ID: Reference5597
Other Names: Methanone, ({bis[(2-chloro-6-fluorophenyl)methyl]amino}oxy)cyclopropyl-
Formula: C18H15Cl2F2NO2
N,N-Bis(2-chloro-6-fluorobenzyl)-N-[(cyclopropylcarbonyl)oxy]amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/13/2016 8:16:40 AM |
| InChI | InChI=1S/C18H15Cl2F2NO2/c19-14-3-1-5-16(21)12(14)9-23(25-18(24)11-7-8-11)10-13-15(20)4-2-6-17(13)22/h1-6,11H,7-10H2 |
| InChI Key | SMWKEVYICMFZQH-UHFFFAOYSA-N |
| Canonical SMILES | C1CC1C(=O)ON(CC2=C(C=CC=C2Cl)F)CC3=C(C=CC=C3Cl)F |
| CAS | |
| Splash | |
| Other Names | Methanone, ({bis[(2-chloro-6-fluorophenyl)methyl]amino}oxy)cyclopropyl- |