Systematic / IUPAC Name: 3-Chloro-N-{methyl(oxido)[5-(trifluoromethyl)-2-pyridinyl]-λ6-sulfanylidene}-5-(trifluoromethyl)-2-pyridinecarboxamide
ID: Reference5600
Other Names: 2-Pyridinecarboxamide, 3-chloro-N-[methyloxido[5-(trifluoromethyl)-2-pyridinyl]sulfanylidene]-5-(trifluoromethyl)-
Formula: C14H8ClF6N3O2S
3-Chloro-N-{methyl(oxo)[5-(trifluoromethyl)-2-pyridinyl]-λ6-sulfanylidene}-5-(trifluoromethyl)-2-pyridinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/13/2016 9:15:58 AM |
| InChI | InChI=1S/C14H8ClF6N3O2S/c1-27(26,10-3-2-7(5-22-10)13(16,17)18)24-12(25)11-9(15)4-8(6-23-11)14(19,20)21/h2-6H,1H3 |
| InChI Key | BQTUVMXCJYCJBW-UHFFFAOYSA-N |
| Canonical SMILES | CS(=NC(=O)C1=C(C=C(C=N1)C(F)(F)F)Cl)(=O)C2=NC=C(C=C2)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 2-Pyridinecarboxamide, 3-chloro-N-[methyloxido[5-(trifluoromethyl)-2-pyridinyl]sulfanylidene]-5-(trifluoromethyl)- |