Systematic / IUPAC Name: N-[(2,3-Dihydro-1,4-benzodioxin-2-ylmethyl)carbamothioyl]-4-methylbenzamide
ID: Reference5605
Other Names: Benzamide, N-({[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]amino}thioxomethyl)-4-methyl-
Formula: C18H18N2O3S
N-(2,3-Dihydro-1,4-benzodioxin-2-ylmethyl)-N'-(4-methylbenzoyl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 216 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/13/2016 11:44:17 AM |
| InChI | InChI=1S/C18H18N2O3S/c1-12-6-8-13(9-7-12)17(21)20-18(24)19-10-14-11-22-15-4-2-3-5-16(15)23-14/h2-9,14H,10-11H2,1H3,(H2,19,20,21,24) |
| InChI Key | OZWPDDIBWGQDBZ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)NC(=S)NCC2COC3=CC=CC=C3O2 |
| CAS | |
| Splash | |
| Other Names | Benzamide, N-({[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]amino}thioxomethyl)-4-methyl- |