Systematic / IUPAC Name: 4-(4-Chlorophenyl)-2-{[2-(phenylsulfonyl)ethyl]sulfanyl}pyrimidine
ID: Reference5610
Other Names: Pyrimidine, 4-(4-chlorophenyl)-2-{[2-(phenylsulfonyl)ethyl]thio}-
Formula: C18H15ClN2O2S2
4-(4-Chlorophenyl)-2-{[2-(phenylsulfonyl)ethyl]thio}pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/13/2016 2:29:13 PM |
| InChI | InChI=1S/C18H15ClN2O2S2/c19-15-8-6-14(7-9-15)17-10-11-20-18(21-17)24-12-13-25(22,23)16-4-2-1-3-5-16/h1-11H,12-13H2 |
| InChI Key | RCAHMKFNAHOZAQ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)S(=O)(=O)CCSC2=NC=CC(=N2)C3=CC=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names | Pyrimidine, 4-(4-chlorophenyl)-2-{[2-(phenylsulfonyl)ethyl]thio}- |