Systematic / IUPAC Name: 2-(3,5-Dimethyl-1H-pyrazol-1-yl)-4-(2-furyl)-6-(methylsulfanyl)-5-pyrimidinecarbonitrile
ID: Reference5614
Other Names: 5-Pyrimidinecarbonitrile, 2-(3,5-dimethyl-1H-pyrazol-1-yl)-4-(2-furanyl)-6-(methylthio)-
Formula: C15H13N5OS
2-(3,5-Dimethyl-1H-pyrazol-1-yl)-4-(2-furyl)-6-(methylthio)pyrimidine-5-carbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/14/2016 8:02:43 AM |
| InChI | InChI=1S/C15H13N5OS/c1-9-7-10(2)20(19-9)15-17-13(12-5-4-6-21-12)11(8-16)14(18-15)22-3/h4-7H,1-3H3 |
| InChI Key | XIYOSRGHFGTBOS-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=NN1C2=NC(=C(C(=N2)SC)C#N)C3=CC=CO3)C |
| CAS | |
| Splash | |
| Other Names | 5-Pyrimidinecarbonitrile, 2-(3,5-dimethyl-1H-pyrazol-1-yl)-4-(2-furanyl)-6-(methylthio)- |