Systematic / IUPAC Name: 1-{5-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]-2-thienyl}-3-[3-(trifluoromethyl)phenyl]urea
ID: Reference5623
Other Names:
1-{5-[2-Methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl}-3-[3-(trifluoromethyl)phenyl]urea ;
Urea, N-{5-[1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]-2-thienyl}-N'-[3-(trifluoromethyl)phenyl]-
Formula: C17H12F6N4OS
N-{5-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]-2-thienyl}-N'-[3-(trifluoromethyl)phenyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/14/2016 1:27:58 PM |
| InChI | InChI=1S/C17H12F6N4OS/c1-27-11(8-13(26-27)17(21,22)23)12-5-6-14(29-12)25-15(28)24-10-4-2-3-9(7-10)16(18,19)20/h2-8H,1H3,(H2,24,25,28) |
| InChI Key | HGMSIFPMRNSKFF-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C(F)(F)F)C2=CC=C(S2)NC(=O)NC3=CC=CC(=C3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
1-{5-[2-Methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl}-3-[3-(trifluoromethyl)phenyl]urea ; Urea, N-{5-[1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]-2-thienyl}-N'-[3-(trifluoromethyl)phenyl]- |
| PubChem | 2820493 |
| ChEMBL | CHEMBL2402102 |
| ChemSpider | 2098722 |