Systematic / IUPAC Name: N'-Hydroxy-2-(2-thienylsulfanyl)ethanimidamide
ID: Reference5629
Other Names: Ethanimidamide, N'-hydroxy-2-(2-thienylthio)-
Formula: C6H8N2OS2
N'-Hydroxy-2-(2-thienylthio)ethanimidamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/15/2016 10:24:20 AM |
| InChI | InChI=1S/C6H8N2OS2/c7-5(8-9)4-11-6-2-1-3-10-6/h1-3,9H,4H2,(H2,7,8) |
| InChI Key | KRQWWVFKOGUDDY-UHFFFAOYSA-N |
| Canonical SMILES | C1=CSC(=C1)SCC(=NO)N |
| CAS | |
| Splash | |
| Other Names | Ethanimidamide, N'-hydroxy-2-(2-thienylthio)- |