Systematic / IUPAC Name: 4-Amino-7-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carboxamide
ID: Reference5635
Other Names: Pyrazolo[5,1-c][1,2,4]triazine-3-carboxamide, 4-amino-7-phenyl-
Formula: C12H10N6O
4-Amino-7-phenylpyrazolo[5,1-c][1,2,4]triazine-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/19/2016 8:17:47 AM |
| InChI | InChI=1S/C12H10N6O/c13-11-10(12(14)19)16-15-9-6-8(17-18(9)11)7-4-2-1-3-5-7/h1-6H,13H2,(H2,14,19) |
| InChI Key | VPZFYJBHUQOXSF-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=NN3C(=C2)N=NC(=C3N)C(=O)N |
| CAS | |
| Splash | |
| Other Names | Pyrazolo[5,1-c][1,2,4]triazine-3-carboxamide, 4-amino-7-phenyl- |