Systematic / IUPAC Name: N-(4-Chloro-2,5-dimethoxyphenyl)-2-(4-nitrobenzoyl)hydrazinecarbothioamide
ID: Reference5636
Other Names: Benzoic acid, 4-nitro, 2-{[(4-chloro-2,5-dimethoxyphenyl)amino]thioxomethyl}hydrazide
Formula: C16H15ClN4O5S
N-(4-Chloro-2,5-dimethoxyphenyl)-2-(4-nitrobenzoyl)hydrazine-1-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 229 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/19/2016 9:09:31 AM |
| InChI | InChI=1S/C16H15ClN4O5S/c1-25-13-8-12(14(26-2)7-11(13)17)18-16(27)20-19-15(22)9-3-5-10(6-4-9)21(23)24/h3-8H,1-2H3,(H,19,22)(H2,18,20,27) |
| InChI Key | UPGTXXHHHNSDIP-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Benzoic acid, 4-nitro, 2-{[(4-chloro-2,5-dimethoxyphenyl)amino]thioxomethyl}hydrazide |