Systematic / IUPAC Name: (2-{[5-(Ethoxycarbonyl)-2-(4-morpholinyl)phenyl]amino}-2-oxoethoxy)acetic acid
ID: Reference5658
Other Names:
2-({[5-(Ethoxycarbonyl)-2-(morpholin-4-yl)phenyl]carbamoyl}methoxy)acetic acid;
Benzoic acid, 3-{[2-(carboxymethoxy)acetyl]amino}-4-(4-morpholinyl)-, 1-ethyl ester
Formula: C17H22N2O7
2-{2-[5-(Ethoxycarbonyl)-2-morpholinoanilino]-2-oxoethoxy}acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/20/2016 12:43:38 PM |
| InChI | InChI=1S/C17H22N2O7/c1-2-26-17(23)12-3-4-14(19-5-7-24-8-6-19)13(9-12)18-15(20)10-25-11-16(21)22/h3-4,9H,2,5-8,10-11H2,1H3,(H,18,20)(H,21,22) |
| InChI Key | CWOKIISJEHAUAY-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=CC(=C(C=C1)N2CCOCC2)NC(=O)COCC(=O)O |
| CAS | |
| Splash | |
| Other Names |
2-({[5-(Ethoxycarbonyl)-2-(morpholin-4-yl)phenyl]carbamoyl}methoxy)acetic acid; Benzoic acid, 3-{[2-(carboxymethoxy)acetyl]amino}-4-(4-morpholinyl)-, 1-ethyl ester |
| PubChem | 2811005 |
| ChEMBL | CHEMBL1456952 |
| ChemSpider | 2089419 |