Systematic / IUPAC Name: N-(1-Benzyl-4-piperidinyl)-2-methyl-5-(2-methyl-2-propanyl)-3-furamide
ID: Reference5671
Other Names:
N-(1-Benzylpiperidin-4-yl)-5-tert-butyl-2-methylfuran-3-carboxamide;
3-Furancarboxamide, 5-(1,1-dimethylethyl)-2-methyl-N-[1-(phenylmethyl)-4-piperidinyl]-
Formula: C22H30N2O2
N-(1-Benzyl-4-piperidinyl)-5-(tert-butyl)-2-methyl-3-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/21/2016 1:22:37 PM |
| InChI | InChI=1S/C22H30N2O2/c1-16-19(14-20(26-16)22(2,3)4)21(25)23-18-10-12-24(13-11-18)15-17-8-6-5-7-9-17/h5-9,14,18H,10-13,15H2,1-4H3,(H,23,25) |
| InChI Key | ZVSMRJPFRGZBAR-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=C(O1)C(C)(C)C)C(=O)NC2CCN(CC2)CC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
N-(1-Benzylpiperidin-4-yl)-5-tert-butyl-2-methylfuran-3-carboxamide; 3-Furancarboxamide, 5-(1,1-dimethylethyl)-2-methyl-N-[1-(phenylmethyl)-4-piperidinyl]- |
| ChEMBL | CHEMBL1718613 |
| PubChem | 2811922 |
| ChemSpider | 2090332 |