Systematic / IUPAC Name: N-[5-Ethyl-3-(4-methoxybenzoyl)-2-thienyl]-4-(trifluoromethyl)benzamide
ID: Reference5681
Other Names: Benzamide, N-[5-ethyl-3-(4-methoxybenzoyl)-2-thienyl]-4-(trifluoromethyl)-
Formula: C22H18F3NO3S
N-[5-Ethyl-3-(4-methoxybenzoyl)-2-thienyl]-4-(trifluoromethyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/22/2016 11:13:40 AM |
| InChI | InChI=1S/C22H18F3NO3S/c1-3-17-12-18(19(27)13-6-10-16(29-2)11-7-13)21(30-17)26-20(28)14-4-8-15(9-5-14)22(23,24)25/h4-12H,3H2,1-2H3,(H,26,28) |
| InChI Key | HJUAELIOHPJFRM-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC(=C(S1)NC(=O)C2=CC=C(C=C2)C(F)(F)F)C(=O)C3=CC=C(C=C3)OC |
| CAS | |
| Splash | |
| Other Names | Benzamide, N-[5-ethyl-3-(4-methoxybenzoyl)-2-thienyl]-4-(trifluoromethyl)- |