Systematic / IUPAC Name: [4-(Aminomethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate
ID: Reference569
Other Names:
4-Aminomethyl-5-hydroxy-6-methyl-3-pyridylmethyl phosphate;
{[4-(Aminomethyl)-5-hydroxy-6-methylpyridin-3-yl]methoxy}phosphonic acid;
Pyridoxamine 5-phosphate
Formula: C8H13N2O5P
Class: Endogenous Metabolites
Pyridoxamine 5-phosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 254 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/6/2015 3:19:43 PM |
| InChI | InChI=1S/C8H13N2O5P/c1-5-8(11)7(2-9)6(3-10-5)4-15-16(12,13)14/h3,11H,2,4,9H2,1H3,(H2,12,13,14) |
| InChI Key | ZMJGSOSNSPKHNH-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NC=C(C(=C1O)CN)COP(=O)(O)O |
| CAS | 529964 |
| Splash | |
| Other Names |
4-Aminomethyl-5-hydroxy-6-methyl-3-pyridylmethyl phosphate; {[4-(Aminomethyl)-5-hydroxy-6-methylpyridin-3-yl]methoxy}phosphonic acid; Pyridoxamine 5-phosphate |
| ChemIDPlus | 000529964 |
| HMDb | HMDB01555 |
| ChEMBL | CHEMBL1235353 |
| ChemSpider | 1024 |
| ChEBI | CHEBI:18335 |
| KEGG | C00647 |
| PubChem | 1053 |