Systematic / IUPAC Name: 1-Phenyl-2-(1-pyrrolidinyl)-1-butanone
ID: Reference5704
Other Names:
α-PBP ;
1-Phenyl-2-(pyrrolidin-1-yl)butan-1-one
Formula: C14H19NO
Class: Drugs of Abuse/Illegal Drugs
α-Pyrrolidinobutiophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/27/2016 7:59:43 AM |
| InChI | InChI=1S/C14H19NO/c1-2-13(15-10-6-7-11-15)14(16)12-8-4-3-5-9-12/h3-5,8-9,13H,2,6-7,10-11H2,1H3 |
| InChI Key | GSESDIFGJCCBHN-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C(=O)C1=CC=CC=C1)N2CCCC2 |
| CAS | |
| Splash | |
| Other Names |
α-PBP ; 1-Phenyl-2-(pyrrolidin-1-yl)butan-1-one |
| ChemSpider | 16251917 |
| PubChem | 23199082 |
| Wikipedia | Alpha-Pyrrolidinobutiophenone |