Systematic / IUPAC Name: 2-(2,5-Dimethoxy-4-nitrophenyl)ethanamine
ID: Reference5707
Other Names:
2,5-Dimethoxy-4-nitrophenethylamine;
Ethanamine, 2-(2,5-dimethoxy-4-nitrophenyl)-
Formula: C10H14N2O4
Class: Drugs of Abuse/Illegal Drugs
2C-N mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/27/2016 10:03:25 AM |
| InChI | InChI=1S/C10H14N2O4/c1-15-9-6-8(12(13)14)10(16-2)5-7(9)3-4-11/h5-6H,3-4,11H2,1-2H3 |
| InChI Key | ZMUSDZGRRJGRAO-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 261789008 |
| Splash | |
| Other Names |
2,5-Dimethoxy-4-nitrophenethylamine; Ethanamine, 2-(2,5-dimethoxy-4-nitrophenyl)- |