Systematic / IUPAC Name: [1-(4-Fluorobenzyl)-1H-indol-3-yl](1-naphthyl)methanone
ID: Reference5723
Other Names: Methanone, {1-[(4-fluorophenyl)methyl]-1H-indol-3-yl}-1-naphthalenyl-
Formula: C26H18FNO
Class: Drugs of Abuse/Illegal Drugs
FUB-JWH 018 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/30/2016 7:47:23 AM |
| InChI | InChI=1S/C26H18FNO/c27-20-14-12-18(13-15-20)16-28-17-24(22-9-3-4-11-25(22)28)26(29)23-10-5-7-19-6-1-2-8-21(19)23/h1-15,17H,16H2 |
| InChI Key | VREQTLWJHFQLEX-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)C3=CN(C4=CC=CC=C43)CC5=CC=C(C=C5)F |
| CAS | |
| Splash | |
| Other Names | Methanone, {1-[(4-fluorophenyl)methyl]-1H-indol-3-yl}-1-naphthalenyl- |
| PubChem | 121489975 |
| Wikipedia | FUB-JWH-018 |
| ChemSpider | 34450892 |