Systematic / IUPAC Name: 1-(3,4-Dimethylphenyl)-2-(ethylamino)-1-propanone
ID: Reference5737
Other Names: 1-Propanone, 1-(3,4-dimethylphenyl)-2-(ethylamino)-
Formula: C13H19NO
Class: Drugs of Abuse/Illegal Drugs
3,4-Dimethylethcathinone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/3/2016 11:24:55 AM |
| InChI | InChI=1S/C13H19NO/c1-5-14-11(4)13(15)12-7-6-9(2)10(3)8-12/h6-8,11,14H,5H2,1-4H3 |
| InChI Key | AOXOTNQJKCPNGK-UHFFFAOYSA-N |
| Canonical SMILES | CCNC(C)C(=O)C1=CC(=C(C=C1)C)C |
| CAS | |
| Splash | |
| Other Names | 1-Propanone, 1-(3,4-dimethylphenyl)-2-(ethylamino)- |