Systematic / IUPAC Name: 2-(Dimethylamino)-1-(4-methylphenyl)-1-propanone
ID: Reference5762
Other Names: 1-Propanone, 2-(dimethylamino)-1-(4-methylphenyl)-
Formula: C12H17NO
Class: Drugs of Abuse/Illegal Drugs
4-Methyl-N,N-dimethylcathinone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/5/2016 8:37:44 AM |
| InChI | InChI=1S/C12H17NO/c1-9-5-7-11(8-6-9)12(14)10(2)13(3)4/h5-8,10H,1-4H3 |
| InChI Key | FXLSIGLYVVJURY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)C(C)N(C)C |
| CAS | |
| Splash | |
| Other Names | 1-Propanone, 2-(dimethylamino)-1-(4-methylphenyl)- |