Systematic / IUPAC Name: 2-(3-Chlorophenyl)-3,5,5-trimethyl-2-morpholinol
ID: Reference5765
Other Names:
Bupropion morpholinol;
2-(3-Chlorophenyl)-3,5,5-trimethylmorpholin-2-ol
Formula: C13H18ClNO2
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs
Hydroxy bupropion mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/5/2016 11:31:39 AM |
| InChI | InChI=1S/C13H18ClNO2/c1-9-13(16,17-8-12(2,3)15-9)10-5-4-6-11(14)7-10/h4-7,9,15-16H,8H2,1-3H3 |
| InChI Key | RCOBKSKAZMVBHT-UHFFFAOYSA-N |
| Canonical SMILES | CC1C(OCC(N1)(C)C)(C2=CC(=CC=C2)Cl)O |
| CAS | 357399430 |
| Splash | |
| Other Names |
Bupropion morpholinol; 2-(3-Chlorophenyl)-3,5,5-trimethylmorpholin-2-ol |
| ChemSpider | 8013686 |
| Wikipedia | Hydroxybupropion |
| PubChem | 9837966 |