Systematic / IUPAC Name: 2,4-Dihydroxy-3-[(1R,6R)-6-isopropenyl-3-methyl-2-cyclohexen-1-yl]-6-pentylbenzoic acid
ID: Reference5775
Other Names:
CBDA;
2,4-Dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-6-pentylbenzoic acid;
3-p-Mentha-1,8-dien-3-yl-6-pentyl-β-resorcylic acid;
Benzoic acid, 2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]-6-pentyl-
Formula: C22H30O4
Class: Drugs of Abuse/Illegal Drugs Endogenous Metabolites
Cannabidiolic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 464 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/7/2016 7:51:15 AM |
| InChI | InChI=1S/C22H30O4/c1-5-6-7-8-15-12-18(23)20(21(24)19(15)22(25)26)17-11-14(4)9-10-16(17)13(2)3/h11-12,16-17,23-24H,2,5-10H2,1,3-4H3,(H,25,26)/t16-,17+/m0/s1 |
| InChI Key | WVOLTBSCXRRQFR-DLBZAZTESA-N |
| Canonical SMILES | CCCCCC1=CC(=C(C(=C1C(=O)O)O)C2C=C(CCC2C(=C)C)C)O |
| CAS | 1244582 |
| Splash | |
| Other Names |
CBDA; 2,4-Dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-6-pentylbenzoic acid; 3-p-Mentha-1,8-dien-3-yl-6-pentyl-β-resorcylic acid; Benzoic acid, 2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]-6-pentyl- |
| ChEBI | CHEBI:3359 |
| KEGG | C10784 |
| ChemIDPlus | 001244582 |
| ChemSpider | 141099 |
| ChEMBL | CHEMBL498672 |
| PubChem | 160570 |