Systematic / IUPAC Name: N-[(2S)-1-Phenyl-2-propanyl]-L-lysinamide
ID: Reference5779
Other Names:
(2S)-2,6-Diamino-N-[(1S)-1-methyl-2-phenylethyl]hexanamide dimethanesulfonate;
(2S)-2,6-Diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide;
(2S)-2,6-Diamino-N-[(2S)-1-phenylpropan-2-yl]hexanimidic acid;
L-Lysine-dextroamphetamine ;
Vyvanse
Formula: C15H25N3O
Class: Drugs of Abuse/Illegal Drugs
Lisdexamfetamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/19/2016 8:14:37 AM |
| InChI | InChI=1S/C15H25N3O/c1-12(11-13-7-3-2-4-8-13)18-15(19)14(17)9-5-6-10-16/h2-4,7-8,12,14H,5-6,9-11,16-17H2,1H3,(H,18,19)/t12-,14-/m0/s1 |
| InChI Key | VOBHXZCDAVEXEY-JSGCOSHPSA-N |
| Canonical SMILES | CC(CC1=CC=CC=C1)NC(=O)C(CCCCN)N |
| CAS | |
| Splash | |
| Other Names |
(2S)-2,6-Diamino-N-[(1S)-1-methyl-2-phenylethyl]hexanamide dimethanesulfonate; (2S)-2,6-Diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide; (2S)-2,6-Diamino-N-[(2S)-1-phenylpropan-2-yl]hexanimidic acid; L-Lysine-dextroamphetamine ; Vyvanse |
| ChemSpider | 9772458 |
| DrugBank | DB01255 |
| Wikipedia | Lisdexamfetamine |
| ChEMBL | CHEMBL1201222 |
| PubChem | 11597698 |
| KEGG | D08130 |
| HMDb | HMDB15385 |