Systematic / IUPAC Name: 1-(2,3-Dihydro-1-benzofuran-5-yl)propan-2-amine
ID: Reference5785
Other Names:
1-(2,3-Dihydro-1-benzofuran-5-yl)-2-propanamine;
5-Benzofuranethanamine, 2,3-dihydro-α-methyl-;
5-(2-Aminopropyl)-2,3-dihydrobenzofuran ;
EMA-4 ;
3-Desoxy-MDA
Formula: C11H15NO
Class: Drugs of Abuse/Illegal Drugs
5-APDB mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/20/2016 7:02:10 AM |
| InChI | InChI=1S/C11H15NO/c1-8(12)6-9-2-3-11-10(7-9)4-5-13-11/h2-3,7-8H,4-6,12H2,1H3 |
| InChI Key | PZTJXZKNTPCPJL-UHFFFAOYSA-N |
| Canonical SMILES | CC(CC1=CC2=C(C=C1)OCC2)N |
| CAS | 152624038 |
| Splash | |
| Other Names |
1-(2,3-Dihydro-1-benzofuran-5-yl)-2-propanamine; 5-Benzofuranethanamine, 2,3-dihydro-α-methyl-; 5-(2-Aminopropyl)-2,3-dihydrobenzofuran ; EMA-4 ; 3-Desoxy-MDA |
| ChemSpider | 167143 |
| Wikipedia | 5-APDB |
| ChEMBL | CHEMBL123351 |
| PubChem | 192601 |
| ChemIDPlus | 152624038 |