Systematic / IUPAC Name: 1-(4-Bromophenyl)-2-(methylamino)-1-propanone
ID: Reference5787
Other Names:
1-(4-Bromophenyl)-2-(methylamino)propan-1-one;
1-Propanone, 1-(4-bromophenyl)-2-(methylamino)-
Formula: C10H12BrNO
Class: Drugs of Abuse/Illegal Drugs
4-Bromomethcathinone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/20/2016 7:19:51 AM |
| InChI | InChI=1S/C10H12BrNO/c1-7(12-2)10(13)8-3-5-9(11)6-4-8/h3-7,12H,1-2H3 |
| InChI Key | OOJXMFNDUXHDOV-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)C1=CC=C(C=C1)Br)NC |
| CAS | |
| Splash | |
| Other Names |
1-(4-Bromophenyl)-2-(methylamino)propan-1-one; 1-Propanone, 1-(4-bromophenyl)-2-(methylamino)- |
| PubChem | 10421832 |
| Wikipedia | 4-Bromomethcathinone |
| ChemSpider | 8597261 |