Systematic / IUPAC Name: [1-(5-Fluoropentyl)-6-nitro-1H-indol-3-yl](1-naphthyl)methanone
ID: Reference5791
Other Names: Methanone, [1-(5-fluoropentyl)-6-nitro-1H-indol-3-yl]-1-naphthalenyl-
Formula: C24H21FN2O3
Class: Drugs of Abuse/Illegal Drugs
AM1235 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/22/2018 7:17:24 AM |
| InChI | InChI=1S/C24H21FN2O3/c25-13-4-1-5-14-26-16-22(20-12-11-18(27(29)30)15-23(20)26)24(28)21-10-6-8-17-7-2-3-9-19(17)21/h2-3,6-12,15-16H,1,4-5,13-14H2 |
| InChI Key | LNGVQORPSNNMSZ-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 335161278 |
| Splash | |
| Other Names | Methanone, [1-(5-fluoropentyl)-6-nitro-1H-indol-3-yl]-1-naphthalenyl- |