Systematic / IUPAC Name: 2-(1,3-Benzodioxol-5-yl)-1-cyclopropyl-N-methylethanamine
ID: Reference5794
Other Names: 1,3-Benzodioxole-5-ethanamine, α-cyclopropyl-N-methyl-
Formula: C13H17NO2
Class: Drugs of Abuse/Illegal Drugs
UWA-101 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/20/2016 10:42:22 AM |
| InChI | InChI=1S/C13H17NO2/c1-14-11(10-3-4-10)6-9-2-5-12-13(7-9)16-8-15-12/h2,5,7,10-11,14H,3-4,6,8H2,1H3 |
| InChI Key | DNROCNZQNQSVOG-UHFFFAOYSA-N |
| Canonical SMILES | CNC(CC1=CC2=C(C=C1)OCO2)C3CC3 |
| CAS | |
| Splash | |
| Other Names | 1,3-Benzodioxole-5-ethanamine, α-cyclopropyl-N-methyl- |
| Wikipedia | UWA-101 |
| ChemSpider | 27444374 |
| PubChem | 17756669 |
| ChEMBL | CHEMBL3302434 |