Systematic / IUPAC Name: [9-(5-Fluoropentyl)-9H-carbazol-3-yl](1-naphthyl)methanone
ID: Reference5802
Other Names:
Methanone, [9-(5-fluoropentyl)-9H-carbazol-3-yl]-1-naphthalenyl-;
[9-(5-fluoropentyl)-9H-carbazol-3-yl](naphthalen-1-yl)methanone
Formula: C28H24FNO
Class: Drugs of Abuse/Illegal Drugs
EG2201 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/21/2016 5:43:39 AM |
| InChI | InChI=1S/C28H24FNO/c29-17-6-1-7-18-30-26-14-5-4-12-23(26)25-19-21(15-16-27(25)30)28(31)24-13-8-10-20-9-2-3-11-22(20)24/h2-5,8-16,19H,1,6-7,17-18H2 |
| InChI Key | LYDDINAZVHIBGP-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)C3=CC4=C(C=C3)N(C5=CC=CC=C54)CCCCCF |
| CAS | |
| Splash | |
| Other Names |
Methanone, [9-(5-fluoropentyl)-9H-carbazol-3-yl]-1-naphthalenyl-; [9-(5-fluoropentyl)-9H-carbazol-3-yl](naphthalen-1-yl)methanone |