Systematic / IUPAC Name: 1-(3-Methylphenyl)-2-pyrrolidin-1-ylbutan-1-one
ID: Reference5806
Other Names:
3-Methyl-a-pyrrolidinobutiophenone;
3-Methyl PBP
Formula: C15H21NO
Class: Drugs of Abuse/Illegal Drugs
3-Methyl-α-pyrrolidinobutiophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/21/2016 12:57:30 PM |
| InChI | InChI=1S/C15H21NO/c1-3-14(16-9-4-5-10-16)15(17)13-8-6-7-12(2)11-13/h6-8,11,14H,3-5,9-10H2,1-2H3 |
| InChI Key | GHUHXBRSGNJMFC-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C(=O)C1=CC(=CC=C1)C)N2CCCC2 |
| CAS | |
| Splash | |
| Other Names |
3-Methyl-a-pyrrolidinobutiophenone; 3-Methyl PBP |
| PubChem | 91704995 |