Systematic / IUPAC Name: 2-(4-Bromo-2,5-dimethoxyphenyl)-N-(2-hydroxybenzyl)ethanaminium (chloride)
ID: Reference5808
Other Names:
2-(4-Bromo-2,5-dimethoxyphenyl)-N-(2-hydroxybenzyl)ethanaminium (chloride) ;
Phenol, 2-({[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]amino}methyl)-, (hydrochloride)
Formula: C17H20BrNO3
Class: Drugs of Abuse/Illegal Drugs
25B-NBOH mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/21/2016 1:07:35 PM |
| InChI | InChI=1S/C17H20BrNO3.ClH/c1-21-16-10-14(18)17(22-2)9-12(16)7-8-19-11-13-5-3-4-6-15(13)20;/h3-6,9-10,19-20H,7-8,11H2,1-2H3;1H |
| InChI Key | POIOFOVTMBOTDN-UHFFFAOYSA-N |
| Canonical SMILES | BrC1=CC(OC)=C(CCNCC2=C(O)C=CC=C2)C=C1OC.Cl |
| CAS | |
| Splash | |
| Other Names |
2-(4-Bromo-2,5-dimethoxyphenyl)-N-(2-hydroxybenzyl)ethanaminium (chloride) ; Phenol, 2-({[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]amino}methyl)-, (hydrochloride) |