Systematic / IUPAC Name: 1-[4-(Isopropylsulfanyl)-2,5-dimethoxyphenyl]-2-propanamine
ID: Reference5814
Other Names:
1-(2,5-Dimethoxy-4-i-propylthiophenyl)-2- ;
1-[4-(Isopropylthio)-2,5-dimethoxyphenyl]propan-2-amine ;
2-(4-Isopropylsulfanyl-2,5-dimethoxy-phenyl)-1-methyl-ethylamine;
2,5-Dimethoxy-4-iso-propylthioamphetamine ;
Benzeneethanamine, 2,5-dimethoxy-α-methyl-4-[(1-methylethyl)thio]-
Formula: C14H23NO2S
Class: Drugs of Abuse/Illegal Drugs
ALEPH-4 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/24/2016 9:12:34 AM |
| InChI | InChI=1S/C14H23NO2S/c1-9(2)18-14-8-12(16-4)11(6-10(3)15)7-13(14)17-5/h7-10H,6,15H2,1-5H3 |
| InChI Key | BCWCXWKCQMBFBQ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)SC1=C(C=C(C(=C1)OC)CC(C)N)OC |
| CAS | 123643265 |
| Splash | |
| Other Names |
1-(2,5-Dimethoxy-4-i-propylthiophenyl)-2- ; 1-[4-(Isopropylthio)-2,5-dimethoxyphenyl]propan-2-amine ; 2-(4-Isopropylsulfanyl-2,5-dimethoxy-phenyl)-1-methyl-ethylamine; 2,5-Dimethoxy-4-iso-propylthioamphetamine ; Benzeneethanamine, 2,5-dimethoxy-α-methyl-4-[(1-methylethyl)thio]- |
| PubChem | 44350301 |
| ChemSpider | 21500994 |
| ChEMBL | CHEMBL127653 |
| Wikipedia | Aleph (psychedelic) |