Systematic / IUPAC Name: (2R)-2-Phenyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetonitrile
ID: Reference5830
Other Names:
(-)-(2R)-Prunasin;
(R)-Prunasin;
α-(β-D-Glucopyranosyloxy)benzeneacetonitrile;
D-Prunasin;
(2R)-(β-D-Glucopyranosyloxy)(phenyl)acetonitrile
; more
Formula: C14H17NO6
Class: Endogenous Metabolites
(R)-Prunasin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/22/2022 1:05:04 PM |
| InChI | InChI=1S/C14H17NO6/c15-6-9(8-4-2-1-3-5-8)20-14-13(19)12(18)11(17)10(7-16)21-14/h1-5,9-14,16-19H,7H2/t9-,10+,11+,12-,13+,14+/m0/s1 |
| InChI Key | ZKSZEJFBGODIJW-GMDXDWKASA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(C#N)OC2C(C(C(C(O2)CO)O)O)O |
| CAS | 99183 |
| Splash | |
| Other Names |
(-)-(2R)-Prunasin; (R)-Prunasin; α-(β-D-Glucopyranosyloxy)benzeneacetonitrile; D-Prunasin; (2R)-(β-D-Glucopyranosyloxy)(phenyl)acetonitrile; (R)-(β-D-Glucopyranosyloxy)phenylacetonitrile; (R)-α-(β-D-Glucopyranosyloxy)benzene-acetonitrile; (R)-Mandelonitrile β-D-glucopyranoside; (R)-Mandelonitrile β-D-glucoside; Benzeneacetonitrile, α-(β-D-glucopyranosyloxy)-, (R)-(9CI); D-Mandelonitrile-β-D-glucoside |
| KEGG | C00844 |
| Wikipedia | Prunasin |
| ChEBI | CHEBI:17396 |
| HMDb | HMDB0034934 |
| PubChem | 119033; 119033 |
| ChemSpider | 106360 |
| ChemIDPlus | 000099183 |
| ChEMBL | CHEMBL1778417; U106022 |